C14H18ClF — CID 114349943
1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluoro-2-methylbenzene (PubChem CID 114349943) has the molecular formula C14H18ClF and a molecular weight of 240.75 g/mol. Its IUPAC name is 1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluoro-2-methylbenzene.
| Compound Name | 1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 114349943 |
| Molecular Formula | C14H18ClF |
| Molecular Weight | 240.75 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluoro-2-methylbenzene |
| SMILES | Cc1cc(F)ccc1CC(C)(CCl)C1CC1 |
| InChI | InChI=1S/C14H18ClF/c1-10-7-13(16)6-3-11(10)8-14(2,9-15)12-4-5-12/h3,6-7,12H,4-5,8-9H2,1-2H3 |
| InChIKey | XBOOKIZWIFZTQR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.75 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|