C13H15BrClF — CID 83149908
2-bromo-1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluorobenzene (PubChem CID 83149908) has the molecular formula C13H15BrClF and a molecular weight of 305.62 g/mol. Its IUPAC name is 2-bromo-1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluorobenzene.
| Compound Name | 2-bromo-1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 83149908 |
| Molecular Formula | C13H15BrClF |
| Molecular Weight | 305.62 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 2-bromo-1-(3-chloro-2-cyclopropyl-2-methylpropyl)-4-fluorobenzene |
| SMILES | CC(CCl)(Cc1ccc(F)cc1Br)C1CC1 |
| InChI | InChI=1S/C13H15BrClF/c1-13(8-15,10-3-4-10)7-9-2-5-11(16)6-12(9)14/h2,5-6,10H,3-4,7-8H2,1H3 |
| InChIKey | LSRZLCLJCDOZIZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|