C13H15Cl2F — CID 107893302
1-chloro-4-(3-chloro-2-cyclopropyl-2-methylpropyl)-2-fluorobenzene (PubChem CID 107893302) has the molecular formula C13H15Cl2F and a molecular weight of 261.17 g/mol. Its IUPAC name is 1-chloro-4-(3-chloro-2-cyclopropyl-2-methylpropyl)-2-fluorobenzene.
| Compound Name | 1-chloro-4-(3-chloro-2-cyclopropyl-2-methylpropyl)-2-fluorobenzene |
|---|---|
| PubChem CID | 107893302 |
| Molecular Formula | C13H15Cl2F |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-chloro-4-(3-chloro-2-cyclopropyl-2-methylpropyl)-2-fluorobenzene |
| SMILES | CC(CCl)(Cc1ccc(Cl)c(F)c1)C1CC1 |
| InChI | InChI=1S/C13H15Cl2F/c1-13(8-14,10-3-4-10)7-9-2-5-11(15)12(16)6-9/h2,5-6,10H,3-4,7-8H2,1H3 |
| InChIKey | LWNNZLAFDCCYFX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|