C19H20F4N2O — CID 95141541
1,3-bis[(2R)-1-(2,6-difluorophenyl)propan-2-yl]urea (PubChem CID 95141541) has the molecular formula C19H20F4N2O and a molecular weight of 368.37 g/mol. Its IUPAC name is 1,3-bis[(2R)-1-(2,6-difluorophenyl)propan-2-yl]urea.
| Compound Name | 1,3-bis[(2R)-1-(2,6-difluorophenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 95141541 |
| Molecular Formula | C19H20F4N2O |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1,3-bis[(2R)-1-(2,6-difluorophenyl)propan-2-yl]urea |
| SMILES | C[C@H](Cc1c(F)cccc1F)NC(=O)N[C@H](C)Cc1c(F)cccc1F |
| InChI | InChI=1S/C19H20F4N2O/c1-11(9-13-15(20)5-3-6-16(13)21)24-19(26)25-12(2)10-14-17(22)7-4-8-18(14)23/h3-8,11-12H,9-10H2,1-2H3,(H2,24,25,26)/t11-,12-/m1/s1 |
| InChIKey | PURSKOMUVBDNNT-VXGBXAGGSA-N |
| XLogP | 4.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |