C13H15F2NO — CID 61027207
N-[1-(2,6-difluorophenyl)propan-2-yl]cyclopropanecarboxamide (PubChem CID 61027207) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)propan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-(2,6-difluorophenyl)propan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 61027207 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)propan-2-yl]cyclopropanecarboxamide |
| SMILES | CC(Cc1c(F)cccc1F)NC(=O)C1CC1 |
| InChI | InChI=1S/C13H15F2NO/c1-8(16-13(17)9-5-6-9)7-10-11(14)3-2-4-12(10)15/h2-4,8-9H,5-7H2,1H3,(H,16,17) |
| InChIKey | UBNYSDLUHAWHLP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |