C12H13F2NO — CID 60932780
N-[1-(2,6-difluorophenyl)propan-2-yl]prop-2-enamide (PubChem CID 60932780) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)propan-2-yl]prop-2-enamide.
| Compound Name | N-[1-(2,6-difluorophenyl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 60932780 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)propan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H13F2NO/c1-3-12(16)15-8(2)7-9-10(13)5-4-6-11(9)14/h3-6,8H,1,7H2,2H3,(H,15,16) |
| InChIKey | ZLCKYHNLGMTHPK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|