C18H19ClF2N2O — CID 55922684
1-[2-(3-chlorophenyl)ethyl]-3-[1-(2,6-difluorophenyl)propan-2-yl]urea (PubChem CID 55922684) has the molecular formula C18H19ClF2N2O and a molecular weight of 352.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[1-(2,6-difluorophenyl)propan-2-yl]urea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[1-(2,6-difluorophenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 55922684 |
| Molecular Formula | C18H19ClF2N2O |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[1-(2,6-difluorophenyl)propan-2-yl]urea |
| SMILES | CC(Cc1c(F)cccc1F)NC(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClF2N2O/c1-12(10-15-16(20)6-3-7-17(15)21)23-18(24)22-9-8-13-4-2-5-14(19)11-13/h2-7,11-12H,8-10H2,1H3,(H2,22,23,24) |
| InChIKey | PWYKPKBEYAYOSC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |