C12H18O3 — CID 24856463
(1R)-2,2-diethoxy-1-phenylethanol (PubChem CID 24856463) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1R)-2,2-diethoxy-1-phenylethanol.
| Compound Name | (1R)-2,2-diethoxy-1-phenylethanol |
|---|---|
| PubChem CID | 24856463 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1R)-2,2-diethoxy-1-phenylethanol |
| SMILES | CCOC(OCC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H18O3/c1-3-14-12(15-4-2)11(13)10-8-6-5-7-9-10/h5-9,11-13H,3-4H2,1-2H3/t11-/m1/s1 |
| InChIKey | YSGJEEVUJUHJOJ-LLVKDONJSA-N |
| XLogP | 2.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|