C14H18O3 — CID 95737739
(1R)-4,4-diethoxy-1-phenylbut-2-yn-1-ol (PubChem CID 95737739) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1R)-4,4-diethoxy-1-phenylbut-2-yn-1-ol.
| Compound Name | (1R)-4,4-diethoxy-1-phenylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 95737739 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1R)-4,4-diethoxy-1-phenylbut-2-yn-1-ol |
| SMILES | CCOC(C#C[C@H](O)c1ccccc1)OCC |
| InChI | InChI=1S/C14H18O3/c1-3-16-14(17-4-2)11-10-13(15)12-8-6-5-7-9-12/h5-9,13-15H,3-4H2,1-2H3/t13-/m0/s1 |
| InChIKey | GZLWMAJAHRHXHJ-ZDUSSCGKSA-N |
| XLogP | 2.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|