C9H8O2 — CID 67894112
3-phenylprop-1-yne-1,3-diol (PubChem CID 67894112) has the molecular formula C9H8O2 and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-phenylprop-1-yne-1,3-diol.
| Compound Name | 3-phenylprop-1-yne-1,3-diol |
|---|---|
| PubChem CID | 67894112 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 3-phenylprop-1-yne-1,3-diol |
| SMILES | OC#CC(O)c1ccccc1 |
| InChI | InChI=1S/C9H8O2/c10-7-6-9(11)8-4-2-1-3-5-8/h1-5,9-11H |
| InChIKey | IEURLESSIOKNLX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|