C20H16O2 — CID 11029274
(Z,1S,8R)-1,8-diphenyloct-4-en-2,6-diyne-1,8-diol (PubChem CID 11029274) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (Z,1S,8R)-1,8-diphenyloct-4-en-2,6-diyne-1,8-diol.
| Compound Name | (Z,1S,8R)-1,8-diphenyloct-4-en-2,6-diyne-1,8-diol |
|---|---|
| PubChem CID | 11029274 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (Z,1S,8R)-1,8-diphenyloct-4-en-2,6-diyne-1,8-diol |
| SMILES | O[C@H](C#C/C=C\C#C[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16O2/c21-19(17-11-5-3-6-12-17)15-9-1-2-10-16-20(22)18-13-7-4-8-14-18/h1-8,11-14,19-22H/b2-1-/t19-,20+ |
| InChIKey | MRVZSQBOSSHQLD-DZNLNZEASA-N |
| XLogP | 3.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|