About 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol
3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol (PubChem CID 162101855) has the molecular formula C13H17ClO2
and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol |
| PubChem CID | 162101855 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol |
| SMILES | CC#CC(O)c1ccccc1.OCCCCl |
| InChI | InChI=1S/C10H10O.C3H7ClO/c1-2-6-10(11)9-7-4-3-5-8-9;4-2-1-3-5/h3-5,7-8,10-11H,1H3;5H,1-3H2 |
| InChIKey | ZEZLYMKBEPGUIX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol?
The IUPAC name of 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol (CID 162101855) is 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol.
What is the SMILES notation for 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol?
The canonical SMILES for 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol is CC#CC(O)c1ccccc1.OCCCCl.
What is the InChIKey of 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol?
The InChIKey is ZEZLYMKBEPGUIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O.C3H7ClO/c1-2-6-10(11)9-7-4-3-5-8-9;4-2-1-3-5/h3-5,7-8,10-11H,1H3;5H,1-3H2.
What are the key properties of 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol?
3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol has a molecular weight of 240.73 g/mol, XLogP of 2.35, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropan-1-ol;1-phenylbut-2-yn-1-ol is sourced from PubChem (CID 162101855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).