C16H20O3 — CID 101388650
(E,3R)-6,6-diethoxy-1-phenylhex-1-en-4-yn-3-ol (PubChem CID 101388650) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (E,3R)-6,6-diethoxy-1-phenylhex-1-en-4-yn-3-ol.
| Compound Name | (E,3R)-6,6-diethoxy-1-phenylhex-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 101388650 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (E,3R)-6,6-diethoxy-1-phenylhex-1-en-4-yn-3-ol |
| SMILES | CCOC(C#C[C@H](O)/C=C/c1ccccc1)OCC |
| InChI | InChI=1S/C16H20O3/c1-3-18-16(19-4-2)13-12-15(17)11-10-14-8-6-5-7-9-14/h5-11,15-17H,3-4H2,1-2H3/b11-10+/t15-/m1/s1 |
| InChIKey | AJWUPBARRSBFJH-AUECHBEKSA-N |
| XLogP | 2.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|