C14H14O — CID 71614789
(1E,3R)-6-methyl-1-phenylhepta-1,6-dien-4-yn-3-ol (PubChem CID 71614789) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is (1E,3R)-6-methyl-1-phenylhepta-1,6-dien-4-yn-3-ol.
| Compound Name | (1E,3R)-6-methyl-1-phenylhepta-1,6-dien-4-yn-3-ol |
|---|---|
| PubChem CID | 71614789 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (1E,3R)-6-methyl-1-phenylhepta-1,6-dien-4-yn-3-ol |
| SMILES | C=C(C)C#C[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H14O/c1-12(2)8-10-14(15)11-9-13-6-4-3-5-7-13/h3-7,9,11,14-15H,1H2,2H3/b11-9+/t14-/m0/s1 |
| InChIKey | XBDLDZNEMOFJAN-MARXPDLDSA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|