C11H14O — CID 10654561
(E,3S)-1-phenylpent-1-en-3-ol (PubChem CID 10654561) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (E,3S)-1-phenylpent-1-en-3-ol.
| Compound Name | (E,3S)-1-phenylpent-1-en-3-ol |
|---|---|
| PubChem CID | 10654561 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (E,3S)-1-phenylpent-1-en-3-ol |
| SMILES | CC[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H14O/c1-2-11(12)9-8-10-6-4-3-5-7-10/h3-9,11-12H,2H2,1H3/b9-8+/t11-/m0/s1 |
| InChIKey | MPQYLVUGJQUTPM-FBOQAHMBSA-N |
| XLogP | 2.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |