C13H16O2 — CID 71601870
(2Z,5R,6E)-7-phenylhepta-2,6-diene-1,5-diol (PubChem CID 71601870) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2Z,5R,6E)-7-phenylhepta-2,6-diene-1,5-diol.
| Compound Name | (2Z,5R,6E)-7-phenylhepta-2,6-diene-1,5-diol |
|---|---|
| PubChem CID | 71601870 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2Z,5R,6E)-7-phenylhepta-2,6-diene-1,5-diol |
| SMILES | OC/C=C\C[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H16O2/c14-11-5-4-8-13(15)10-9-12-6-2-1-3-7-12/h1-7,9-10,13-15H,8,11H2/b5-4-,10-9+/t13-/m1/s1 |
| InChIKey | HGJFJTITFIFLBR-WMQZNJAFSA-N |
| XLogP | 2.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|