C11H11NO — CID 11052128
(E,3S)-3-hydroxy-5-phenylpent-4-enenitrile (PubChem CID 11052128) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is (E,3S)-3-hydroxy-5-phenylpent-4-enenitrile.
| Compound Name | (E,3S)-3-hydroxy-5-phenylpent-4-enenitrile |
|---|---|
| PubChem CID | 11052128 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (E,3S)-3-hydroxy-5-phenylpent-4-enenitrile |
| SMILES | N#CC[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H11NO/c12-9-8-11(13)7-6-10-4-2-1-3-5-10/h1-7,11,13H,8H2/b7-6+/t11-/m1/s1 |
| InChIKey | WEHZRPSWGSRWCV-XUIVZRPNSA-N |
| XLogP | 1.97 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |