C12H12O — CID 11041183
(E,3R)-1-phenylhex-1-en-5-yn-3-ol (PubChem CID 11041183) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is (E,3R)-1-phenylhex-1-en-5-yn-3-ol.
| Compound Name | (E,3R)-1-phenylhex-1-en-5-yn-3-ol |
|---|---|
| PubChem CID | 11041183 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (E,3R)-1-phenylhex-1-en-5-yn-3-ol |
| SMILES | C#CC[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H12O/c1-2-6-12(13)10-9-11-7-4-3-5-8-11/h1,3-5,7-10,12-13H,6H2/b10-9+/t12-/m1/s1 |
| InChIKey | GFEXJIFQSYBITL-BZYZDCJZSA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|