C12H11BrO — CID 129385185
(Z,3S)-2-bromo-1-phenylhex-1-en-5-yn-3-ol (PubChem CID 129385185) has the molecular formula C12H11BrO and a molecular weight of 251.12 g/mol. Its IUPAC name is (Z,3S)-2-bromo-1-phenylhex-1-en-5-yn-3-ol.
| Compound Name | (Z,3S)-2-bromo-1-phenylhex-1-en-5-yn-3-ol |
|---|---|
| PubChem CID | 129385185 |
| Molecular Formula | C12H11BrO |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | (Z,3S)-2-bromo-1-phenylhex-1-en-5-yn-3-ol |
| SMILES | C#CC[C@H](O)/C(Br)=C/c1ccccc1 |
| InChI | InChI=1S/C12H11BrO/c1-2-6-12(14)11(13)9-10-7-4-3-5-8-10/h1,3-5,7-9,12,14H,6H2/b11-9-/t12-/m0/s1 |
| InChIKey | QYLMGNKXBSZXPK-MMRAYRKESA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|