C10H12O3 — CID 5463840
(Z)-4-phenylbut-3-ene-1,2,3-triol (PubChem CID 5463840) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (Z)-4-phenylbut-3-ene-1,2,3-triol.
| Compound Name | (Z)-4-phenylbut-3-ene-1,2,3-triol |
|---|---|
| PubChem CID | 5463840 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (Z)-4-phenylbut-3-ene-1,2,3-triol |
| SMILES | OCC(O)/C(O)=C/c1ccccc1 |
| InChI | InChI=1S/C10H12O3/c11-7-10(13)9(12)6-8-4-2-1-3-5-8/h1-6,10-13H,7H2/b9-6- |
| InChIKey | FSDPQZPRLPFVLK-TWGQIWQCSA-N |
| XLogP | 0.94 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|