C21H24O6 — CID 66583957
(3S,4S,5S,6R)-7-methoxy-1,8-diphenylocta-1,7-diene-2,3,4,5,6-pentol (PubChem CID 66583957) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3S,4S,5S,6R)-7-methoxy-1,8-diphenylocta-1,7-diene-2,3,4,5,6-pentol.
| Compound Name | (3S,4S,5S,6R)-7-methoxy-1,8-diphenylocta-1,7-diene-2,3,4,5,6-pentol |
|---|---|
| PubChem CID | 66583957 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (3S,4S,5S,6R)-7-methoxy-1,8-diphenylocta-1,7-diene-2,3,4,5,6-pentol |
| SMILES | COC(=Cc1ccccc1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=Cc1ccccc1 |
| InChI | InChI=1S/C21H24O6/c1-27-17(13-15-10-6-3-7-11-15)19(24)21(26)20(25)18(23)16(22)12-14-8-4-2-5-9-14/h2-13,18-26H,1H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | RGDZYDLAOISUKJ-PLACYPQZSA-N |
| XLogP | 1.72 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|