C11H11FO4 — CID 70422301
3-fluoro-2,4-dihydroxy-5-phenylpent-4-enoic acid (PubChem CID 70422301) has the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. Its IUPAC name is 3-fluoro-2,4-dihydroxy-5-phenylpent-4-enoic acid.
| Compound Name | 3-fluoro-2,4-dihydroxy-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 70422301 |
| Molecular Formula | C11H11FO4 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-fluoro-2,4-dihydroxy-5-phenylpent-4-enoic acid |
| SMILES | O=C(O)C(O)C(F)C(O)=Cc1ccccc1 |
| InChI | InChI=1S/C11H11FO4/c12-9(10(14)11(15)16)8(13)6-7-4-2-1-3-5-7/h1-6,9-10,13-14H,(H,15,16) |
| InChIKey | GAKABGGYTMDBDQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|