C9H7ClF2 — CID 175913510
(2-chloro-3,3-difluoroprop-1-enyl)benzene (PubChem CID 175913510) has the molecular formula C9H7ClF2 and a molecular weight of 188.60 g/mol. Its IUPAC name is (2-chloro-3,3-difluoroprop-1-enyl)benzene.
| Compound Name | (2-chloro-3,3-difluoroprop-1-enyl)benzene |
|---|---|
| PubChem CID | 175913510 |
| Molecular Formula | C9H7ClF2 |
| Molecular Weight | 188.60 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | (2-chloro-3,3-difluoroprop-1-enyl)benzene |
| SMILES | FC(F)C(Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C9H7ClF2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6,9H |
| InChIKey | PKESAUWDGOJLHJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |