About CID 11750295
CID 11750295 (PubChem CID 11750295) has the molecular formula C8H6FGe
and a molecular weight of 193.74 g/mol.
Molecular Properties
| Compound Name | CID 11750295 |
| PubChem CID | 11750295 |
| Molecular Formula | C8H6FGe |
| Molecular Weight | 193.74 g/mol |
| Exact Mass | 194.97 |
| IUPAC Name | — |
| SMILES | F/C([Ge])=C\c1ccccc1 |
| InChI | InChI=1S/C8H6FGe/c9-8(10)6-7-4-2-1-3-5-7/h1-6H/b8-6+ |
| InChIKey | GXOYQSTUAJQOMM-SOFGYWHQSA-N |
| XLogP | 2.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11750295 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11750295?
The IUPAC name of CID 11750295 (CID 11750295) is not available.
What is the SMILES notation for CID 11750295?
The canonical SMILES for CID 11750295 is F/C([Ge])=C\c1ccccc1.
What is the InChIKey of CID 11750295?
The InChIKey is GXOYQSTUAJQOMM-SOFGYWHQSA-N. The full InChI is InChI=1S/C8H6FGe/c9-8(10)6-7-4-2-1-3-5-7/h1-6H/b8-6+.
What are the key properties of CID 11750295?
CID 11750295 has a molecular weight of 193.74 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11750295 is sourced from PubChem (CID 11750295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).