C11H11F — CID 12586000
[(1E)-3-fluoro-2-methylbuta-1,3-dienyl]benzene (PubChem CID 12586000) has the molecular formula C11H11F and a molecular weight of 162.21 g/mol. Its IUPAC name is [(1E)-3-fluoro-2-methylbuta-1,3-dienyl]benzene.
| Compound Name | [(1E)-3-fluoro-2-methylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 12586000 |
| Molecular Formula | C11H11F |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | [(1E)-3-fluoro-2-methylbuta-1,3-dienyl]benzene |
| SMILES | C=C(F)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C11H11F/c1-9(10(2)12)8-11-6-4-3-5-7-11/h3-8H,2H2,1H3/b9-8+ |
| InChIKey | CBLMILTVYRTGEG-CMDGGOBGSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|