C11H10F4 — CID 90783714
2,2-difluoroethenylbenzene;1,1-difluoroprop-1-ene (PubChem CID 90783714) has the molecular formula C11H10F4 and a molecular weight of 218.19 g/mol. Its IUPAC name is 2,2-difluoroethenylbenzene;1,1-difluoroprop-1-ene.
| Compound Name | 2,2-difluoroethenylbenzene;1,1-difluoroprop-1-ene |
|---|---|
| PubChem CID | 90783714 |
| Molecular Formula | C11H10F4 |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2,2-difluoroethenylbenzene;1,1-difluoroprop-1-ene |
| SMILES | CC=C(F)F.FC(F)=Cc1ccccc1 |
| InChI | InChI=1S/C8H6F2.C3H4F2/c9-8(10)6-7-4-2-1-3-5-7;1-2-3(4)5/h1-6H;2H,1H3 |
| InChIKey | CRPPTZNQOHIZLN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |