C9H8F2 — CID 6424286
1-(2,2-difluoroethenyl)-4-methylbenzene (PubChem CID 6424286) has the molecular formula C9H8F2 and a molecular weight of 154.16 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)-4-methylbenzene.
| Compound Name | 1-(2,2-difluoroethenyl)-4-methylbenzene |
|---|---|
| PubChem CID | 6424286 |
| Molecular Formula | C9H8F2 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-(2,2-difluoroethenyl)-4-methylbenzene |
| SMILES | Cc1ccc(C=C(F)F)cc1 |
| InChI | InChI=1S/C9H8F2/c1-7-2-4-8(5-3-7)6-9(10)11/h2-6H,1H3 |
| InChIKey | KBWXMNYOXWDCEA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |