C17H15FO — CID 102132917
(Z)-2-fluoro-1,3-bis(4-methylphenyl)prop-2-en-1-one (PubChem CID 102132917) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is (Z)-2-fluoro-1,3-bis(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (Z)-2-fluoro-1,3-bis(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102132917 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (Z)-2-fluoro-1,3-bis(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C(\F)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H15FO/c1-12-3-7-14(8-4-12)11-16(18)17(19)15-9-5-13(2)6-10-15/h3-11H,1-2H3/b16-11- |
| InChIKey | YSYNQGIFHYBGFF-WJDWOHSUSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|