C32H28O2 — CID 12516207
(Z)-1,2,3,4-tetrakis(4-methylphenyl)but-2-ene-1,4-dione (PubChem CID 12516207) has the molecular formula C32H28O2 and a molecular weight of 444.57 g/mol. Its IUPAC name is (Z)-1,2,3,4-tetrakis(4-methylphenyl)but-2-ene-1,4-dione.
| Compound Name | (Z)-1,2,3,4-tetrakis(4-methylphenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 12516207 |
| Molecular Formula | C32H28O2 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (Z)-1,2,3,4-tetrakis(4-methylphenyl)but-2-ene-1,4-dione |
| SMILES | Cc1ccc(C(=O)/C(=C(\C(=O)c2ccc(C)cc2)c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H28O2/c1-21-5-13-25(14-6-21)29(31(33)27-17-9-23(3)10-18-27)30(26-15-7-22(2)8-16-26)32(34)28-19-11-24(4)12-20-28/h5-20H,1-4H3/b30-29- |
| InChIKey | HDLDSOLNPYFMTL-FLWNBWAVSA-N |
| XLogP | 7.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|