C25H24O2 — CID 137447920
(Z)-3-(3,5-dimethylphenyl)-2,3-bis(4-methylphenyl)prop-2-enoic acid (PubChem CID 137447920) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (Z)-3-(3,5-dimethylphenyl)-2,3-bis(4-methylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3,5-dimethylphenyl)-2,3-bis(4-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 137447920 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (Z)-3-(3,5-dimethylphenyl)-2,3-bis(4-methylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(/C(C(=O)O)=C(\c2ccc(C)cc2)c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C25H24O2/c1-16-5-9-20(10-6-16)23(22-14-18(3)13-19(4)15-22)24(25(26)27)21-11-7-17(2)8-12-21/h5-15H,1-4H3,(H,26,27)/b24-23- |
| InChIKey | IYJQMMMZRXZCPQ-VHXPQNKSSA-N |
| XLogP | 5.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|