1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen

C17H18O — CID 144635959

IUPAC1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen
SMILESC=C(C(=O)c1ccc(C)cc1)c1ccc(C)cc1.[H][H]
InChIInChI=1S/C17H16O.H2/c1-12-4-8-15(9-5-12)14(3)17(18)16-10-6-13(2)7-11-16;/h4-11H,3H2,1-2H3;1H
InChIKeyLSGILWIPWXNEHI-UHFFFAOYSA-N
MW238.33 g/mol
LogP4.45
Rot. Bonds3

About 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen

1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen (PubChem CID 144635959) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen.

Molecular Properties

Compound Name1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen
PubChem CID144635959
Molecular FormulaC17H18O
Molecular Weight238.33 g/mol
Exact Mass238.14
IUPAC Name1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen
SMILESC=C(C(=O)c1ccc(C)cc1)c1ccc(C)cc1.[H][H]
InChIInChI=1S/C17H16O.H2/c1-12-4-8-15(9-5-12)14(3)17(18)16-10-6-13(2)7-11-16;/h4-11H,3H2,1-2H3;1H
InChIKeyLSGILWIPWXNEHI-UHFFFAOYSA-N
XLogP4.45
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.33
LogP ≤ 54.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen?
The IUPAC name of 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen (CID 144635959) is 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen.
What is the SMILES notation for 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen?
The canonical SMILES for 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen is C=C(C(=O)c1ccc(C)cc1)c1ccc(C)cc1.[H][H].
What is the InChIKey of 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen?
The InChIKey is LSGILWIPWXNEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O.H2/c1-12-4-8-15(9-5-12)14(3)17(18)16-10-6-13(2)7-11-16;/h4-11H,3H2,1-2H3;1H.
What are the key properties of 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen?
1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen has a molecular weight of 238.33 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen is sourced from PubChem (CID 144635959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).