C17H18O — CID 144635959
1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen (PubChem CID 144635959) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen.
| Compound Name | 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen |
|---|---|
| PubChem CID | 144635959 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1,2-bis(4-methylphenyl)prop-2-en-1-one;molecular hydrogen |
| SMILES | C=C(C(=O)c1ccc(C)cc1)c1ccc(C)cc1.[H][H] |
| InChI | InChI=1S/C17H16O.H2/c1-12-4-8-15(9-5-12)14(3)17(18)16-10-6-13(2)7-11-16;/h4-11H,3H2,1-2H3;1H |
| InChIKey | LSGILWIPWXNEHI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|