C28H34 — CID 123373957
1,4-bis[1-(4-methylphenyl)ethenyl]benzene;ethane (PubChem CID 123373957) has the molecular formula C28H34 and a molecular weight of 370.58 g/mol. Its IUPAC name is 1,4-bis[1-(4-methylphenyl)ethenyl]benzene;ethane.
| Compound Name | 1,4-bis[1-(4-methylphenyl)ethenyl]benzene;ethane |
|---|---|
| PubChem CID | 123373957 |
| Molecular Formula | C28H34 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1,4-bis[1-(4-methylphenyl)ethenyl]benzene;ethane |
| SMILES | C=C(c1ccc(C)cc1)c1ccc(C(=C)c2ccc(C)cc2)cc1.CC.CC |
| InChI | InChI=1S/C24H22.2C2H6/c1-17-5-9-21(10-6-17)19(3)23-13-15-24(16-14-23)20(4)22-11-7-18(2)8-12-22;2*1-2/h5-16H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | KEHCKURXNQIERQ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |