C28H24O2 — CID 162199896
1-[1-(4-methoxyphenyl)ethenyl]-4-[4-(4-methylphenyl)phenoxy]benzene (PubChem CID 162199896) has the molecular formula C28H24O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)ethenyl]-4-[4-(4-methylphenyl)phenoxy]benzene.
| Compound Name | 1-[1-(4-methoxyphenyl)ethenyl]-4-[4-(4-methylphenyl)phenoxy]benzene |
|---|---|
| PubChem CID | 162199896 |
| Molecular Formula | C28H24O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)ethenyl]-4-[4-(4-methylphenyl)phenoxy]benzene |
| SMILES | C=C(c1ccc(OC)cc1)c1ccc(Oc2ccc(-c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H24O2/c1-20-4-6-24(7-5-20)25-12-18-28(19-13-25)30-27-16-10-23(11-17-27)21(2)22-8-14-26(29-3)15-9-22/h4-19H,2H2,1,3H3 |
| InChIKey | VUJPSMKASYDHFC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |