C33H28O3 — CID 144891551
formaldehyde;1-[4-(4-methoxyphenyl)phenyl]-4-[4-(4-methylphenyl)phenoxy]benzene (PubChem CID 144891551) has the molecular formula C33H28O3 and a molecular weight of 472.58 g/mol. Its IUPAC name is formaldehyde;1-[4-(4-methoxyphenyl)phenyl]-4-[4-(4-methylphenyl)phenoxy]benzene.
| Compound Name | formaldehyde;1-[4-(4-methoxyphenyl)phenyl]-4-[4-(4-methylphenyl)phenoxy]benzene |
|---|---|
| PubChem CID | 144891551 |
| Molecular Formula | C33H28O3 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | formaldehyde;1-[4-(4-methoxyphenyl)phenyl]-4-[4-(4-methylphenyl)phenoxy]benzene |
| SMILES | C=O.COc1ccc(-c2ccc(-c3ccc(Oc4ccc(-c5ccc(C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26O2.CH2O/c1-23-3-5-24(6-4-23)28-13-19-31(20-14-28)34-32-21-15-29(16-22-32)26-9-7-25(8-10-26)27-11-17-30(33-2)18-12-27;1-2/h3-22H,1-2H3;1H2 |
| InChIKey | OAHKSYHRXWJVKS-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |