About ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide
ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide (PubChem CID 91209459) has the molecular formula C18H26O3S
and a molecular weight of 322.47 g/mol. Its IUPAC name is ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide.
Molecular Properties
| Compound Name | ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide |
| PubChem CID | 91209459 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide |
| SMILES | CC.CC.COc1ccc(Oc2ccc(C)cc2)cc1.O=S |
| InChI | InChI=1S/C14H14O2.2C2H6.OS/c1-11-3-5-13(6-4-11)16-14-9-7-12(15-2)8-10-14;3*1-2/h3-10H,1-2H3;2*1-2H3; |
| InChIKey | GBIQSGMXSKHJGL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide?
The IUPAC name of ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide (CID 91209459) is ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide.
What is the SMILES notation for ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide?
The canonical SMILES for ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide is CC.CC.COc1ccc(Oc2ccc(C)cc2)cc1.O=S.
What is the InChIKey of ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide?
The InChIKey is GBIQSGMXSKHJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.2C2H6.OS/c1-11-3-5-13(6-4-11)16-14-9-7-12(15-2)8-10-14;3*1-2/h3-10H,1-2H3;2*1-2H3;.
What are the key properties of ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide?
ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide has a molecular weight of 322.47 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-4-(4-methylphenoxy)benzene;sulfur monoxide is sourced from PubChem (CID 91209459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).