About methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene
methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene (PubChem CID 160612603) has the molecular formula C22H26O
and a molecular weight of 306.45 g/mol. Its IUPAC name is methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene.
Molecular Properties
| Compound Name | methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene |
| PubChem CID | 160612603 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene |
| SMILES | C.COc1ccc(C)cc1.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C8H10O.CH4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-7-3-5-8(9-2)6-4-7;/h2-10H,1H3;3-6H,1-2H3;1H4 |
| InChIKey | RFRJFEXWEDVNGA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene?
The IUPAC name of methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene (CID 160612603) is methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene.
What is the SMILES notation for methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene?
The canonical SMILES for methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene is C.COc1ccc(C)cc1.Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene?
The InChIKey is RFRJFEXWEDVNGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C8H10O.CH4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-7-3-5-8(9-2)6-4-7;/h2-10H,1H3;3-6H,1-2H3;1H4.
What are the key properties of methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene?
methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene has a molecular weight of 306.45 g/mol, XLogP of 6.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxy-4-methylbenzene;1-methyl-4-phenylbenzene is sourced from PubChem (CID 160612603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).