About 1-methoxy-4-phenylbenzene;methyloxidanium
1-methoxy-4-phenylbenzene;methyloxidanium (PubChem CID 144616924) has the molecular formula C14H17O2+
and a molecular weight of 217.29 g/mol. Its IUPAC name is 1-methoxy-4-phenylbenzene;methyloxidanium.
Molecular Properties
| Compound Name | 1-methoxy-4-phenylbenzene;methyloxidanium |
| PubChem CID | 144616924 |
| Molecular Formula | C14H17O2+ |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-methoxy-4-phenylbenzene;methyloxidanium |
| SMILES | COc1ccc(-c2ccccc2)cc1.C[OH2+] |
| InChI | InChI=1S/C13H12O.CH4O/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2/h2-10H,1H3;2H,1H3/p+1 |
| InChIKey | RPMDILXHPYGXHC-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 32.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-4-phenylbenzene;methyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-phenylbenzene;methyloxidanium?
The IUPAC name of 1-methoxy-4-phenylbenzene;methyloxidanium (CID 144616924) is 1-methoxy-4-phenylbenzene;methyloxidanium.
What is the SMILES notation for 1-methoxy-4-phenylbenzene;methyloxidanium?
The canonical SMILES for 1-methoxy-4-phenylbenzene;methyloxidanium is COc1ccc(-c2ccccc2)cc1.C[OH2+].
What is the InChIKey of 1-methoxy-4-phenylbenzene;methyloxidanium?
The InChIKey is RPMDILXHPYGXHC-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H12O.CH4O/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2/h2-10H,1H3;2H,1H3/p+1.
What are the key properties of 1-methoxy-4-phenylbenzene;methyloxidanium?
1-methoxy-4-phenylbenzene;methyloxidanium has a molecular weight of 217.29 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-phenylbenzene;methyloxidanium is sourced from PubChem (CID 144616924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).