About sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene
sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene (PubChem CID 162208171) has the molecular formula C20H20F3OS+
and a molecular weight of 365.44 g/mol. Its IUPAC name is sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene.
Molecular Properties
| Compound Name | sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene |
| PubChem CID | 162208171 |
| Molecular Formula | C20H20F3OS+ |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene |
| SMILES | COc1ccc(-c2ccc(-c3ccccc3)cc2)cc1.FC(F)F.[SH3+] |
| InChI | InChI=1S/C19H16O.CHF3.H2S/c1-20-19-13-11-18(12-14-19)17-9-7-16(8-10-17)15-5-3-2-4-6-15;2-1(3)4;/h2-14H,1H3;1H;1H2/p+1 |
| InChIKey | ZSMDBQKQAJYKCZ-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene?
The IUPAC name of sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene (CID 162208171) is sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene.
What is the SMILES notation for sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene?
The canonical SMILES for sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene is COc1ccc(-c2ccc(-c3ccccc3)cc2)cc1.FC(F)F.[SH3+].
What is the InChIKey of sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene?
The InChIKey is ZSMDBQKQAJYKCZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H16O.CHF3.H2S/c1-20-19-13-11-18(12-14-19)17-9-7-16(8-10-17)15-5-3-2-4-6-15;2-1(3)4;/h2-14H,1H3;1H;1H2/p+1.
What are the key properties of sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene?
sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene has a molecular weight of 365.44 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanium;fluoroform;1-methoxy-4-(4-phenylphenyl)benzene is sourced from PubChem (CID 162208171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).