About 2-methoxynaphthalene;2-phenylnaphthalene
2-methoxynaphthalene;2-phenylnaphthalene (PubChem CID 173269029) has the molecular formula C27H22O
and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-methoxynaphthalene;2-phenylnaphthalene.
Molecular Properties
| Compound Name | 2-methoxynaphthalene;2-phenylnaphthalene |
| PubChem CID | 173269029 |
| Molecular Formula | C27H22O |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-methoxynaphthalene;2-phenylnaphthalene |
| SMILES | COc1ccc2ccccc2c1.c1ccc(-c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C16H12.C11H10O/c1-2-6-13(7-3-1)16-11-10-14-8-4-5-9-15(14)12-16;1-12-11-7-6-9-4-2-3-5-10(9)8-11/h1-12H;2-8H,1H3 |
| InChIKey | CHNKYTCWAIYJQY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxynaphthalene;2-phenylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxynaphthalene;2-phenylnaphthalene?
The IUPAC name of 2-methoxynaphthalene;2-phenylnaphthalene (CID 173269029) is 2-methoxynaphthalene;2-phenylnaphthalene.
What is the SMILES notation for 2-methoxynaphthalene;2-phenylnaphthalene?
The canonical SMILES for 2-methoxynaphthalene;2-phenylnaphthalene is COc1ccc2ccccc2c1.c1ccc(-c2ccc3ccccc3c2)cc1.
What is the InChIKey of 2-methoxynaphthalene;2-phenylnaphthalene?
The InChIKey is CHNKYTCWAIYJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12.C11H10O/c1-2-6-13(7-3-1)16-11-10-14-8-4-5-9-15(14)12-16;1-12-11-7-6-9-4-2-3-5-10(9)8-11/h1-12H;2-8H,1H3.
What are the key properties of 2-methoxynaphthalene;2-phenylnaphthalene?
2-methoxynaphthalene;2-phenylnaphthalene has a molecular weight of 362.47 g/mol, XLogP of 7.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxynaphthalene;2-phenylnaphthalene is sourced from PubChem (CID 173269029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).