About anisole;1,1'-biphenyl;naphthalene
anisole;1,1'-biphenyl;naphthalene (PubChem CID 161250692) has the molecular formula C29H26O
and a molecular weight of 390.53 g/mol. Its IUPAC name is anisole;1,1'-biphenyl;naphthalene.
Molecular Properties
| Compound Name | anisole;1,1'-biphenyl;naphthalene |
| PubChem CID | 161250692 |
| Molecular Formula | C29H26O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | anisole;1,1'-biphenyl;naphthalene |
| SMILES | COc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10.C10H8.C7H8O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;1-8-7-5-3-2-4-6-7/h1-10H;1-8H;2-6H,1H3 |
| InChIKey | VBFPVKOLLPGQAC-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze anisole;1,1'-biphenyl;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;1,1'-biphenyl;naphthalene?
The IUPAC name of anisole;1,1'-biphenyl;naphthalene (CID 161250692) is anisole;1,1'-biphenyl;naphthalene.
What is the SMILES notation for anisole;1,1'-biphenyl;naphthalene?
The canonical SMILES for anisole;1,1'-biphenyl;naphthalene is COc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1.
What is the InChIKey of anisole;1,1'-biphenyl;naphthalene?
The InChIKey is VBFPVKOLLPGQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H8.C7H8O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;1-8-7-5-3-2-4-6-7/h1-10H;1-8H;2-6H,1H3.
What are the key properties of anisole;1,1'-biphenyl;naphthalene?
anisole;1,1'-biphenyl;naphthalene has a molecular weight of 390.53 g/mol, XLogP of 7.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;1,1'-biphenyl;naphthalene is sourced from PubChem (CID 161250692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).