About anisole;1-bromo-4-(4-bromophenyl)benzene
anisole;1-bromo-4-(4-bromophenyl)benzene (PubChem CID 159969810) has the molecular formula C19H16Br2O
and a molecular weight of 420.14 g/mol. Its IUPAC name is anisole;1-bromo-4-(4-bromophenyl)benzene.
Molecular Properties
| Compound Name | anisole;1-bromo-4-(4-bromophenyl)benzene |
| PubChem CID | 159969810 |
| Molecular Formula | C19H16Br2O |
| Molecular Weight | 420.14 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | anisole;1-bromo-4-(4-bromophenyl)benzene |
| SMILES | Brc1ccc(-c2ccc(Br)cc2)cc1.COc1ccccc1 |
| InChI | InChI=1S/C12H8Br2.C7H8O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-8-7-5-3-2-4-6-7/h1-8H;2-6H,1H3 |
| InChIKey | OEKBEOPOXIWMJS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.14 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze anisole;1-bromo-4-(4-bromophenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;1-bromo-4-(4-bromophenyl)benzene?
The IUPAC name of anisole;1-bromo-4-(4-bromophenyl)benzene (CID 159969810) is anisole;1-bromo-4-(4-bromophenyl)benzene.
What is the SMILES notation for anisole;1-bromo-4-(4-bromophenyl)benzene?
The canonical SMILES for anisole;1-bromo-4-(4-bromophenyl)benzene is Brc1ccc(-c2ccc(Br)cc2)cc1.COc1ccccc1.
What is the InChIKey of anisole;1-bromo-4-(4-bromophenyl)benzene?
The InChIKey is OEKBEOPOXIWMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Br2.C7H8O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-8-7-5-3-2-4-6-7/h1-8H;2-6H,1H3.
What are the key properties of anisole;1-bromo-4-(4-bromophenyl)benzene?
anisole;1-bromo-4-(4-bromophenyl)benzene has a molecular weight of 420.14 g/mol, XLogP of 6.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;1-bromo-4-(4-bromophenyl)benzene is sourced from PubChem (CID 159969810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).