C27H21BrO — CID 132514241
1-bromo-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene (PubChem CID 132514241) has the molecular formula C27H21BrO and a molecular weight of 441.37 g/mol. Its IUPAC name is 1-bromo-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene.
| Compound Name | 1-bromo-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene |
|---|---|
| PubChem CID | 132514241 |
| Molecular Formula | C27H21BrO |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-bromo-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene |
| SMILES | COc1ccc(/C(=C(\c2ccccc2)c2ccc(Br)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21BrO/c1-29-25-18-14-23(15-19-25)27(21-10-6-3-7-11-21)26(20-8-4-2-5-9-20)22-12-16-24(28)17-13-22/h2-19H,1H3/b27-26+ |
| InChIKey | FRDPXFLTRQSBQM-CYYJNZCTSA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|