C26H16Br4 — CID 11828419
1-bromo-4-[1,2,2-tris(4-bromophenyl)ethenyl]benzene (PubChem CID 11828419) has the molecular formula C26H16Br4 and a molecular weight of 648.03 g/mol. Its IUPAC name is 1-bromo-4-[1,2,2-tris(4-bromophenyl)ethenyl]benzene.
| Compound Name | 1-bromo-4-[1,2,2-tris(4-bromophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 11828419 |
| Molecular Formula | C26H16Br4 |
| Molecular Weight | 648.03 g/mol |
| Exact Mass | 643.80 |
| IUPAC Name | 1-bromo-4-[1,2,2-tris(4-bromophenyl)ethenyl]benzene |
| SMILES | Brc1ccc(C(=C(c2ccc(Br)cc2)c2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H16Br4/c27-21-9-1-17(2-10-21)25(18-3-11-22(28)12-4-18)26(19-5-13-23(29)14-6-19)20-7-15-24(30)16-8-20/h1-16H |
| InChIKey | BIRLDGKMJJEZRI-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.03 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|