About 4-bromobenzoic acid;copper
4-bromobenzoic acid;copper (PubChem CID 67824318) has the molecular formula C7H5BrCuO2
and a molecular weight of 264.56 g/mol. Its IUPAC name is 4-bromobenzoic acid;copper.
Molecular Properties
| Compound Name | 4-bromobenzoic acid;copper |
| PubChem CID | 67824318 |
| Molecular Formula | C7H5BrCuO2 |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 262.88 |
| IUPAC Name | 4-bromobenzoic acid;copper |
| SMILES | O=C(O)c1ccc(Br)cc1.[Cu] |
| InChI | InChI=1S/C7H5BrO2.Cu/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10); |
| InChIKey | ILIHMPIZFOBBGE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromobenzoic acid;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzoic acid;copper?
The IUPAC name of 4-bromobenzoic acid;copper (CID 67824318) is 4-bromobenzoic acid;copper.
What is the SMILES notation for 4-bromobenzoic acid;copper?
The canonical SMILES for 4-bromobenzoic acid;copper is O=C(O)c1ccc(Br)cc1.[Cu].
What is the InChIKey of 4-bromobenzoic acid;copper?
The InChIKey is ILIHMPIZFOBBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO2.Cu/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);.
What are the key properties of 4-bromobenzoic acid;copper?
4-bromobenzoic acid;copper has a molecular weight of 264.56 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzoic acid;copper is sourced from PubChem (CID 67824318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).