About 1-bromo-4-methoxybenzene;ethynylbenzene
1-bromo-4-methoxybenzene;ethynylbenzene (PubChem CID 158646754) has the molecular formula C15H13BrO
and a molecular weight of 289.17 g/mol. Its IUPAC name is 1-bromo-4-methoxybenzene;ethynylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-methoxybenzene;ethynylbenzene |
| PubChem CID | 158646754 |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 1-bromo-4-methoxybenzene;ethynylbenzene |
| SMILES | C#Cc1ccccc1.COc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H6.C7H7BrO/c1-2-8-6-4-3-5-7-8;1-9-7-4-2-6(8)3-5-7/h1,3-7H;2-5H,1H3 |
| InChIKey | IBBFUZPACOVCGE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-methoxybenzene;ethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methoxybenzene;ethynylbenzene?
The IUPAC name of 1-bromo-4-methoxybenzene;ethynylbenzene (CID 158646754) is 1-bromo-4-methoxybenzene;ethynylbenzene.
What is the SMILES notation for 1-bromo-4-methoxybenzene;ethynylbenzene?
The canonical SMILES for 1-bromo-4-methoxybenzene;ethynylbenzene is C#Cc1ccccc1.COc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-methoxybenzene;ethynylbenzene?
The InChIKey is IBBFUZPACOVCGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6.C7H7BrO/c1-2-8-6-4-3-5-7-8;1-9-7-4-2-6(8)3-5-7/h1,3-7H;2-5H,1H3.
What are the key properties of 1-bromo-4-methoxybenzene;ethynylbenzene?
1-bromo-4-methoxybenzene;ethynylbenzene has a molecular weight of 289.17 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methoxybenzene;ethynylbenzene is sourced from PubChem (CID 158646754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).