C16H9Br — CID 59747509
1-bromo-4-[2-(4-ethynylphenyl)ethynyl]benzene (PubChem CID 59747509) has the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. Its IUPAC name is 1-bromo-4-[2-(4-ethynylphenyl)ethynyl]benzene.
| Compound Name | 1-bromo-4-[2-(4-ethynylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 59747509 |
| Molecular Formula | C16H9Br |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 1-bromo-4-[2-(4-ethynylphenyl)ethynyl]benzene |
| SMILES | C#Cc1ccc(C#Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H9Br/c1-2-13-3-5-14(6-4-13)7-8-15-9-11-16(17)12-10-15/h1,3-6,9-12H |
| InChIKey | LTEZPBHKAUXYFC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|