C37H49BrO6Si — CID 159320121
(1R)-1-(4-bromophenyl)ethane-1,2-diol;(1R)-1-(4-ethynylphenyl)ethane-1,2-diol;(1R)-1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethane-1,2-diol (PubChem CID 159320121) has the molecular formula C37H49BrO6Si and a molecular weight of 697.78 g/mol. Its IUPAC name is (1R)-1-(4-bromophenyl)ethane-1,2-diol;(1R)-1-(4-ethynylphenyl)ethane-1,2-diol;(1R)-1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethane-1,2-diol.
| Compound Name | (1R)-1-(4-bromophenyl)ethane-1,2-diol;(1R)-1-(4-ethynylphenyl)ethane-1,2-diol;(1R)-1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 159320121 |
| Molecular Formula | C37H49BrO6Si |
| Molecular Weight | 697.78 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | (1R)-1-(4-bromophenyl)ethane-1,2-diol;(1R)-1-(4-ethynylphenyl)ethane-1,2-diol;(1R)-1-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethane-1,2-diol |
| SMILES | C#Cc1ccc([C@@H](O)CO)cc1.CC(C)[Si](C#Cc1ccc([C@@H](O)CO)cc1)(C(C)C)C(C)C.OC[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H30O2Si.C10H10O2.C8H9BrO2/c1-14(2)22(15(3)4,16(5)6)12-11-17-7-9-18(10-8-17)19(21)13-20;1-2-8-3-5-9(6-4-8)10(12)7-11;9-7-3-1-6(2-4-7)8(11)5-10/h7-10,14-16,19-21H,13H2,1-6H3;1,3-6,10-12H,7H2;1-4,8,10-11H,5H2/t19-;10-;8-/m000/s1 |
| InChIKey | LDQQFEOVMFSDNG-CCYMCUEYSA-N |
| XLogP | 6.45 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|