C20H28OSi — CID 101217736
3-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]prop-2-yn-1-ol (PubChem CID 101217736) has the molecular formula C20H28OSi and a molecular weight of 312.53 g/mol. Its IUPAC name is 3-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 101217736 |
| Molecular Formula | C20H28OSi |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 3-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]prop-2-yn-1-ol |
| SMILES | CC(C)[Si](C#Cc1ccc(C#CCO)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H28OSi/c1-16(2)22(17(3)4,18(5)6)15-13-20-11-9-19(10-12-20)8-7-14-21/h9-12,16-18,21H,14H2,1-6H3 |
| InChIKey | AYSYIKVGWUVQKF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|