C35H39NSi — CID 102353310
N,N-dimethyl-4-[2-[4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]ethynyl]aniline (PubChem CID 102353310) has the molecular formula C35H39NSi and a molecular weight of 501.79 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]ethynyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]ethynyl]aniline |
|---|---|
| PubChem CID | 102353310 |
| Molecular Formula | C35H39NSi |
| Molecular Weight | 501.79 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N,N-dimethyl-4-[2-[4-[2-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]ethynyl]phenyl]ethynyl]aniline |
| SMILES | CC(C)[Si](C#Cc1ccc(C#Cc2ccc(C#Cc3ccc(N(C)C)cc3)cc2)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H39NSi/c1-27(2)37(28(3)4,29(5)6)26-25-34-19-17-32(18-20-34)14-13-30-9-11-31(12-10-30)15-16-33-21-23-35(24-22-33)36(7)8/h9-12,17-24,27-29H,1-8H3 |
| InChIKey | RIZPJEVXILNCCY-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.79 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|