C14H19N — CID 146003218
N,N-dimethyl-4-(4-methylpent-1-ynyl)aniline (PubChem CID 146003218) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-methylpent-1-ynyl)aniline.
| Compound Name | N,N-dimethyl-4-(4-methylpent-1-ynyl)aniline |
|---|---|
| PubChem CID | 146003218 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N,N-dimethyl-4-(4-methylpent-1-ynyl)aniline |
| SMILES | CC(C)CC#Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H19N/c1-12(2)6-5-7-13-8-10-14(11-9-13)15(3)4/h8-12H,6H2,1-4H3 |
| InChIKey | CRPYFUQBMAHZKZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|